C14H17NO — CID 102104057
1',7'-diethylspiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 102104057) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 1',7'-diethylspiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 1',7'-diethylspiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102104057 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1',7'-diethylspiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | CCc1cccc2c1N(CC)C(=O)C21CC1 |
| InChI | InChI=1S/C14H17NO/c1-3-10-6-5-7-11-12(10)15(4-2)13(16)14(11)8-9-14/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | IWCZCEIELSPEHB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |