C13H12BrNO3 — CID 132918327
7-bromo-1-methylspiro[indole-3,5'-oxane]-2,2'-dione (PubChem CID 132918327) has the molecular formula C13H12BrNO3 and a molecular weight of 310.15 g/mol. Its IUPAC name is 7-bromo-1-methylspiro[indole-3,5'-oxane]-2,2'-dione.
| Compound Name | 7-bromo-1-methylspiro[indole-3,5'-oxane]-2,2'-dione |
|---|---|
| PubChem CID | 132918327 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 7-bromo-1-methylspiro[indole-3,5'-oxane]-2,2'-dione |
| SMILES | CN1C(=O)C2(CCC(=O)OC2)c2cccc(Br)c21 |
| InChI | InChI=1S/C13H12BrNO3/c1-15-11-8(3-2-4-9(11)14)13(12(15)17)6-5-10(16)18-7-13/h2-4H,5-7H2,1H3 |
| InChIKey | RQSGNOXZCVPUSB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |