C31H66O4SiSn — CID 177477442
2-[[(E,5S,9R)-11-(methoxymethoxy)-9-tributylstannylundec-10-en-5-yl]oxymethoxy]ethyl-trimethylsilane (PubChem CID 177477442) has the molecular formula C31H66O4SiSn and a molecular weight of 649.66 g/mol. Its IUPAC name is 2-[[(E,5S,9R)-11-(methoxymethoxy)-9-tributylstannylundec-10-en-5-yl]oxymethoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(E,5S,9R)-11-(methoxymethoxy)-9-tributylstannylundec-10-en-5-yl]oxymethoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 177477442 |
| Molecular Formula | C31H66O4SiSn |
| Molecular Weight | 649.66 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | 2-[[(E,5S,9R)-11-(methoxymethoxy)-9-tributylstannylundec-10-en-5-yl]oxymethoxy]ethyl-trimethylsilane |
| SMILES | CCCC[C@@H](CCC[C@H](/C=C/OCOC)[Sn](CCCC)(CCCC)CCCC)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C19H39O4Si.3C4H9.Sn/c1-6-7-12-19(23-18-22-15-16-24(3,4)5)13-10-8-9-11-14-21-17-20-2;3*1-3-4-2;/h9,11,14,19H,6-8,10,12-13,15-18H2,1-5H3;3*1,3-4H2,2H3;/b14-11+;;;;/t19-;;;;/m0..../s1 |
| InChIKey | QBRWAPFYXGKRPP-ZJRHICKPSA-N |
| XLogP | 10.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.66 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|