C18H26O8S2 — CID 177480914
[(3E,9S,10S,11R)-9,10,11-triacetyloxy-1,6-dithiacyclododec-3-en-8-yl] acetate (PubChem CID 177480914) has the molecular formula C18H26O8S2 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(3E,9S,10S,11R)-9,10,11-triacetyloxy-1,6-dithiacyclododec-3-en-8-yl] acetate.
| Compound Name | [(3E,9S,10S,11R)-9,10,11-triacetyloxy-1,6-dithiacyclododec-3-en-8-yl] acetate |
|---|---|
| PubChem CID | 177480914 |
| Molecular Formula | C18H26O8S2 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [(3E,9S,10S,11R)-9,10,11-triacetyloxy-1,6-dithiacyclododec-3-en-8-yl] acetate |
| SMILES | CC(=O)OC1CSC/C=C/CSC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O8S2/c1-11(19)23-15-9-27-7-5-6-8-28-10-16(24-12(2)20)18(26-14(4)22)17(15)25-13(3)21/h5-6,15-18H,7-10H2,1-4H3/b6-5+/t15-,16?,17+,18+/m0/s1 |
| InChIKey | WQDMRNAEQIHEGS-WMKKWSRTSA-N |
| XLogP | 1.75 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|