C11H7ClF4O — CID 177481649
2-(2-chlorophenyl)-3,3,4,4-tetrafluoro-5-methylideneoxolane (PubChem CID 177481649) has the molecular formula C11H7ClF4O and a molecular weight of 266.62 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3,3,4,4-tetrafluoro-5-methylideneoxolane.
| Compound Name | 2-(2-chlorophenyl)-3,3,4,4-tetrafluoro-5-methylideneoxolane |
|---|---|
| PubChem CID | 177481649 |
| Molecular Formula | C11H7ClF4O |
| Molecular Weight | 266.62 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-(2-chlorophenyl)-3,3,4,4-tetrafluoro-5-methylideneoxolane |
| SMILES | C=C1OC(c2ccccc2Cl)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H7ClF4O/c1-6-10(13,14)11(15,16)9(17-6)7-4-2-3-5-8(7)12/h2-5,9H,1H2 |
| InChIKey | HBJQCXSRLJSLRB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|