C48H59AlN2OSn — CID 177482552
N-[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-N-[methyl(triphenylstannyloxy)alumanyl]-2,6-di(propan-2-yl)aniline (PubChem CID 177482552) has the molecular formula C48H59AlN2OSn and a molecular weight of 825.71 g/mol. Its IUPAC name is N-[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-N-[methyl(triphenylstannyloxy)alumanyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-N-[methyl(triphenylstannyloxy)alumanyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 177482552 |
| Molecular Formula | C48H59AlN2OSn |
| Molecular Weight | 825.71 g/mol |
| Exact Mass | 826.35 |
| IUPAC Name | N-[(E)-4-[2,6-di(propan-2-yl)phenyl]iminopent-2-en-2-yl]-N-[methyl(triphenylstannyloxy)alumanyl]-2,6-di(propan-2-yl)aniline |
| SMILES | C/C(=C\C(C)=N\c1c(C(C)C)cccc1C(C)C)N(c1c(C(C)C)cccc1C(C)C)[Al](C)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H41N2.3C6H5.CH3.Al.O.Sn/c1-18(2)24-13-11-14-25(19(3)4)28(24)30-22(9)17-23(10)31-29-26(20(5)6)15-12-16-27(29)21(7)8;3*1-2-4-6-5-3-1;;;;/h11-21H,1-10H3;3*1-5H;1H3;;;/q-1;;;;;+1;;/b22-17+,31-23+;;;;;;; |
| InChIKey | BQYJNXOTVVSVFY-AUGQJIKNSA-N |
| XLogP | 11.48 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.71 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|