About CID 139115129
CID 139115129 (PubChem CID 139115129) has the molecular formula C35H48GeN2O4
and a molecular weight of 633.39 g/mol.
Molecular Properties
| Compound Name | CID 139115129 |
| PubChem CID | 139115129 |
| Molecular Formula | C35H48GeN2O4 |
| Molecular Weight | 633.39 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | — |
| SMILES | COC(=O)/C=C(\[Ge]N(/C(C)=C\C(C)=N\c1c(C(C)C)cccc1C(C)C)c1c(C(C)C)cccc1C(C)C)C(=O)OC |
| InChI | InChI=1S/C35H48GeN2O4/c1-21(2)27-15-13-16-28(22(3)4)33(27)37-25(9)19-26(10)38(36-31(35(40)42-12)20-32(39)41-11)34-29(23(5)6)17-14-18-30(34)24(7)8/h13-24H,1-12H3/b26-19-,31-20-,37-25+ |
| InChIKey | KKBCYZBYNDDEQU-DFDNNEJWSA-N |
| XLogP | 8.53 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 633.39 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 139115129 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139115129?
The IUPAC name of CID 139115129 (CID 139115129) is not available.
What is the SMILES notation for CID 139115129?
The canonical SMILES for CID 139115129 is COC(=O)/C=C(\[Ge]N(/C(C)=C\C(C)=N\c1c(C(C)C)cccc1C(C)C)c1c(C(C)C)cccc1C(C)C)C(=O)OC.
What is the InChIKey of CID 139115129?
The InChIKey is KKBCYZBYNDDEQU-DFDNNEJWSA-N. The full InChI is InChI=1S/C35H48GeN2O4/c1-21(2)27-15-13-16-28(22(3)4)33(27)37-25(9)19-26(10)38(36-31(35(40)42-12)20-32(39)41-11)34-29(23(5)6)17-14-18-30(34)24(7)8/h13-24H,1-12H3/b26-19-,31-20-,37-25+.
What are the key properties of CID 139115129?
CID 139115129 has a molecular weight of 633.39 g/mol, XLogP of 8.53, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139115129 is sourced from PubChem (CID 139115129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).