C12H12N2-2 — CID 177484446
2,3,6,7-tetramethyl-4,8-dihydro-1,5-naphthyridine-4,8-diide (PubChem CID 177484446) has the molecular formula C12H12N2-2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-4,8-dihydro-1,5-naphthyridine-4,8-diide.
| Compound Name | 2,3,6,7-tetramethyl-4,8-dihydro-1,5-naphthyridine-4,8-diide |
|---|---|
| PubChem CID | 177484446 |
| Molecular Formula | C12H12N2-2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2,3,6,7-tetramethyl-4,8-dihydro-1,5-naphthyridine-4,8-diide |
| SMILES | Cc1[c-]c2nc(C)c(C)[c-]c2nc1C |
| InChI | InChI=1S/C12H12N2/c1-7-5-11-12(13-9(7)3)6-8(2)10(4)14-11/h1-4H3/q-2 |
| InChIKey | KBGVIPFLNAHRHD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|