C35H35N4O4PS — CID 177486372
(Z)-2-[(4-carbamoylphenyl)-diphenylphosphaniumyl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino]ethenolate (PubChem CID 177486372) has the molecular formula C35H35N4O4PS and a molecular weight of 638.73 g/mol. Its IUPAC name is (Z)-2-[(4-carbamoylphenyl)-diphenylphosphaniumyl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino]ethenolate.
| Compound Name | (Z)-2-[(4-carbamoylphenyl)-diphenylphosphaniumyl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino]ethenolate |
|---|---|
| PubChem CID | 177486372 |
| Molecular Formula | C35H35N4O4PS |
| Molecular Weight | 638.73 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | (Z)-2-[(4-carbamoylphenyl)-diphenylphosphaniumyl]-1-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethylamino]ethenolate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCN/C([O-])=C/[P+](c3ccccc3)(c3ccccc3)c3ccc(C(N)=O)cc3)cccc12 |
| InChI | InChI=1S/C35H35N4O4PS/c1-39(2)32-17-9-16-31-30(32)15-10-18-33(31)45(42,43)38-24-23-37-34(40)25-44(27-11-5-3-6-12-27,28-13-7-4-8-14-28)29-21-19-26(20-22-29)35(36)41/h3-22,25,37-38H,23-24H2,1-2H3,(H2-,36,40,41)/b34-25- |
| InChIKey | LTXVHBDBHMVXTD-NQUVTRGKSA-N |
| XLogP | 3.03 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|