C20H19NO2 — CID 177493075
3-(4-methoxyphenyl)-1'-methylspiro[cyclopentene-4,3'-indole]-2'-one (PubChem CID 177493075) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1'-methylspiro[cyclopentene-4,3'-indole]-2'-one.
| Compound Name | 3-(4-methoxyphenyl)-1'-methylspiro[cyclopentene-4,3'-indole]-2'-one |
|---|---|
| PubChem CID | 177493075 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-1'-methylspiro[cyclopentene-4,3'-indole]-2'-one |
| SMILES | COc1ccc(C2C=CCC23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C20H19NO2/c1-21-18-8-4-3-6-17(18)20(19(21)22)13-5-7-16(20)14-9-11-15(23-2)12-10-14/h3-12,16H,13H2,1-2H3 |
| InChIKey | JONQLRFQEVAWFL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|