C25H21NO3Se — CID 57381170
4-(4-methoxyphenyl)-1'-methyl-3-phenylselanylspiro[2H-furan-5,3'-indole]-2'-one (PubChem CID 57381170) has the molecular formula C25H21NO3Se and a molecular weight of 462.41 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1'-methyl-3-phenylselanylspiro[2H-furan-5,3'-indole]-2'-one.
| Compound Name | 4-(4-methoxyphenyl)-1'-methyl-3-phenylselanylspiro[2H-furan-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 57381170 |
| Molecular Formula | C25H21NO3Se |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 4-(4-methoxyphenyl)-1'-methyl-3-phenylselanylspiro[2H-furan-5,3'-indole]-2'-one |
| SMILES | COc1ccc(C2=C([Se]c3ccccc3)COC23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C25H21NO3Se/c1-26-21-11-7-6-10-20(21)25(24(26)27)23(17-12-14-18(28-2)15-13-17)22(16-29-25)30-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3 |
| InChIKey | PHHGBFIJQBKZKZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|