About anilino(butoxy)methanol
anilino(butoxy)methanol (PubChem CID 177495288) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is anilino(butoxy)methanol.
Molecular Properties
| Compound Name | anilino(butoxy)methanol |
| PubChem CID | 177495288 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | anilino(butoxy)methanol |
| SMILES | CCCCOC(O)Nc1ccccc1 |
| InChI | InChI=1S/C11H17NO2/c1-2-3-9-14-11(13)12-10-7-5-4-6-8-10/h4-8,11-13H,2-3,9H2,1H3 |
| InChIKey | BDMLDHKBYZQFSJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze anilino(butoxy)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilino(butoxy)methanol?
The IUPAC name of anilino(butoxy)methanol (CID 177495288) is anilino(butoxy)methanol.
What is the SMILES notation for anilino(butoxy)methanol?
The canonical SMILES for anilino(butoxy)methanol is CCCCOC(O)Nc1ccccc1.
What is the InChIKey of anilino(butoxy)methanol?
The InChIKey is BDMLDHKBYZQFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-2-3-9-14-11(13)12-10-7-5-4-6-8-10/h4-8,11-13H,2-3,9H2,1H3.
What are the key properties of anilino(butoxy)methanol?
anilino(butoxy)methanol has a molecular weight of 195.26 g/mol, XLogP of 2.19, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anilino(butoxy)methanol is sourced from PubChem (CID 177495288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).