C22H34O4 — CID 177496410
(Z,5R)-5-[(1S,2R,8aR)-2,5,5,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoic acid (PubChem CID 177496410) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (Z,5R)-5-[(1S,2R,8aR)-2,5,5,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoic acid.
| Compound Name | (Z,5R)-5-[(1S,2R,8aR)-2,5,5,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 177496410 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (Z,5R)-5-[(1S,2R,8aR)-2,5,5,8a-tetramethyl-1,2,3,6,7,8-hexahydronaphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoic acid |
| SMILES | CC(=O)O[C@H](C/C(C)=C\C(=O)O)[C@H]1[C@H](C)CC=C2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C22H34O4/c1-14(13-19(24)25)12-17(26-16(3)23)20-15(2)8-9-18-21(4,5)10-7-11-22(18,20)6/h9,13,15,17,20H,7-8,10-12H2,1-6H3,(H,24,25)/b14-13-/t15-,17-,20-,22+/m1/s1 |
| InChIKey | QHHUZWKNDYIHJE-KZRLBQCVSA-N |
| XLogP | 5.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|