C23H32O3 — CID 54590742
(1S,2R,10R,11S)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-7,13,15,17-tetraene (PubChem CID 54590742) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (1S,2R,10R,11S)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-7,13,15,17-tetraene.
| Compound Name | (1S,2R,10R,11S)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-7,13,15,17-tetraene |
|---|---|
| PubChem CID | 54590742 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (1S,2R,10R,11S)-15,16-dimethoxy-2,6,6,10-tetramethyl-12-oxatetracyclo[9.7.0.02,7.013,18]octadeca-7,13,15,17-tetraene |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@@H](O2)[C@H](C)CC=C2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C23H32O3/c1-14-8-9-19-22(2,3)10-7-11-23(19,4)20-15-12-17(24-5)18(25-6)13-16(15)26-21(14)20/h9,12-14,20-21H,7-8,10-11H2,1-6H3/t14-,20+,21+,23+/m1/s1 |
| InChIKey | LZARUCKPZZNRDU-UYILYCRRSA-N |
| XLogP | 5.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|