C27H38O3 — CID 73353788
[(E,5R)-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-3-methylpent-2-enyl] benzoate (PubChem CID 73353788) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [(E,5R)-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-3-methylpent-2-enyl] benzoate.
| Compound Name | [(E,5R)-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-3-methylpent-2-enyl] benzoate |
|---|---|
| PubChem CID | 73353788 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [(E,5R)-5-[(1S,2R,8aS)-1,2,5,5-tetramethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxy-3-methylpent-2-enyl] benzoate |
| SMILES | C/C(=C\COC(=O)c1ccccc1)C[C@@H](O)[C@@]1(C)[C@H](C)CC=C2[C@@H]1CCCC2(C)C |
| InChI | InChI=1S/C27H38O3/c1-19(15-17-30-25(29)21-10-7-6-8-11-21)18-24(28)27(5)20(2)13-14-22-23(27)12-9-16-26(22,3)4/h6-8,10-11,14-15,20,23-24,28H,9,12-13,16-18H2,1-5H3/b19-15+/t20-,23+,24-,27+/m1/s1 |
| InChIKey | IWRWLWUPGHVRFA-DUNNSWMWSA-N |
| XLogP | 6.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|