C20H18ClN3O4S — CID 177498630
1-[(E)-(4-chlorophenyl)methylideneamino]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylideneimidazolidine-4,5-dione (PubChem CID 177498630) has the molecular formula C20H18ClN3O4S and a molecular weight of 431.90 g/mol. Its IUPAC name is 1-[(E)-(4-chlorophenyl)methylideneamino]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylideneimidazolidine-4,5-dione.
| Compound Name | 1-[(E)-(4-chlorophenyl)methylideneamino]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylideneimidazolidine-4,5-dione |
|---|---|
| PubChem CID | 177498630 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 1-[(E)-(4-chlorophenyl)methylideneamino]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylideneimidazolidine-4,5-dione |
| SMILES | COc1ccc(CCN2C(=O)C(=O)N(/N=C/c3ccc(Cl)cc3)C2=S)cc1OC |
| InChI | InChI=1S/C20H18ClN3O4S/c1-27-16-8-5-13(11-17(16)28-2)9-10-23-18(25)19(26)24(20(23)29)22-12-14-3-6-15(21)7-4-14/h3-8,11-12H,9-10H2,1-2H3/b22-12+ |
| InChIKey | KCHMRMJNORRAFU-WSDLNYQXSA-N |
| XLogP | 2.89 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|