C26H42N2O13 — CID 178003475
methanol;methyl (3R)-3,4-diacetyloxy-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-6-hydroxyhexanoate (PubChem CID 178003475) has the molecular formula C26H42N2O13 and a molecular weight of 590.62 g/mol. Its IUPAC name is methanol;methyl (3R)-3,4-diacetyloxy-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-6-hydroxyhexanoate.
| Compound Name | methanol;methyl (3R)-3,4-diacetyloxy-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-6-hydroxyhexanoate |
|---|---|
| PubChem CID | 178003475 |
| Molecular Formula | C26H42N2O13 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | methanol;methyl (3R)-3,4-diacetyloxy-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-6-hydroxyhexanoate |
| SMILES | CO.COC(=O)C(Oc1ccc(CO)cc1C(=O)NCCOCCOCCN)[C@H](OC(C)=O)C(CCO)OC(C)=O |
| InChI | InChI=1S/C25H38N2O12.CH4O/c1-16(30)37-21(6-9-28)22(38-17(2)31)23(25(33)34-3)39-20-5-4-18(15-29)14-19(20)24(32)27-8-11-36-13-12-35-10-7-26;1-2/h4-5,14,21-23,28-29H,6-13,15,26H2,1-3H3,(H,27,32);2H,1H3/t21?,22-,23?;/m1./s1 |
| InChIKey | WWPASIIWIOHNOZ-FBAOXGOFSA-N |
| XLogP | -1.32 |
| TPSA | 222.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|