C23H38N2O9 — CID 178003316
2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamoyl]-4-(methoxymethyl)phenoxy]-4,6-dihydroxyhexanoic acid (PubChem CID 178003316) has the molecular formula C23H38N2O9 and a molecular weight of 486.56 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamoyl]-4-(methoxymethyl)phenoxy]-4,6-dihydroxyhexanoic acid.
| Compound Name | 2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamoyl]-4-(methoxymethyl)phenoxy]-4,6-dihydroxyhexanoic acid |
|---|---|
| PubChem CID | 178003316 |
| Molecular Formula | C23H38N2O9 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethylcarbamoyl]-4-(methoxymethyl)phenoxy]-4,6-dihydroxyhexanoic acid |
| SMILES | COCc1ccc(OC(CC(O)CCO)C(=O)O)c(C(=O)NCCOCCOCCN(C)C)c1 |
| InChI | InChI=1S/C23H38N2O9/c1-25(2)8-11-33-13-12-32-10-7-24-22(28)19-14-17(16-31-3)4-5-20(19)34-21(23(29)30)15-18(27)6-9-26/h4-5,14,18,21,26-27H,6-13,15-16H2,1-3H3,(H,24,28)(H,29,30) |
| InChIKey | UJGXWHPXWBRZHF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|