About (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole
(4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole (PubChem CID 178004012) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole.
Analyze (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole?
The IUPAC name of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole (CID 178004012) is (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole.
What is the SMILES notation for (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole?
The canonical SMILES for (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole is C=C/C=c1/ncs/c1=C/CC.
What is the InChIKey of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole?
The InChIKey is UDKSCWXUFHHYGR-XVYDYJIPSA-N. The full InChI is InChI=1S/C9H11NS/c1-3-5-8-9(6-4-2)11-7-10-8/h3,5-7H,1,4H2,2H3/b8-5+,9-6+.
What are the key properties of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole?
(4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole has a molecular weight of 165.26 g/mol, XLogP of 1.30, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-thiazole is sourced from PubChem (CID 178004012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).