C10H21FNO+ — CID 178006126
(3R,4R)-4-ethyl-3-fluoro-1-hydroxy-1-propan-2-ylpiperidin-1-ium (PubChem CID 178006126) has the molecular formula C10H21FNO+ and a molecular weight of 190.28 g/mol. Its IUPAC name is (3R,4R)-4-ethyl-3-fluoro-1-hydroxy-1-propan-2-ylpiperidin-1-ium.
| Compound Name | (3R,4R)-4-ethyl-3-fluoro-1-hydroxy-1-propan-2-ylpiperidin-1-ium |
|---|---|
| PubChem CID | 178006126 |
| Molecular Formula | C10H21FNO+ |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | (3R,4R)-4-ethyl-3-fluoro-1-hydroxy-1-propan-2-ylpiperidin-1-ium |
| SMILES | CC[C@@H]1CC[N+](O)(C(C)C)C[C@@H]1F |
| InChI | InChI=1S/C10H21FNO/c1-4-9-5-6-12(13,8(2)3)7-10(9)11/h8-10,13H,4-7H2,1-3H3/q+1/t9-,10+,12?/m1/s1 |
| InChIKey | ZZJHQFSBRJNGEV-WFCWDVHWSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|