C15H20F3N3O3 — CID 178007578
2-(3-methylbut-1-ynyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 178007578) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is 2-(3-methylbut-1-ynyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 2-(3-methylbut-1-ynyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 178007578 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(3-methylbut-1-ynyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC(C)C#CC1OCCC(O)C1O.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H16O3.C5H4F3N3/c1-7(2)3-4-9-10(12)8(11)5-6-13-9;6-5(7,8)3-1-10-2-4(9)11-3/h7-12H,5-6H2,1-2H3;1-2H,(H2,9,11) |
| InChIKey | AIGKULRYYLCXJM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|