About N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane
N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane (PubChem CID 178010302) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane.
Molecular Properties
| Compound Name | N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane |
| PubChem CID | 178010302 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane |
| SMILES | C/C=C/CNC(=O)C1CCC1.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-2-3-7-10-9(11)8-5-4-6-8;1-2/h2-3,8H,4-7H2,1H3,(H,10,11);1-2H3/b3-2+; |
| InChIKey | FYONLDZFRBWSAW-SQQVDAMQSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane?
The IUPAC name of N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane (CID 178010302) is N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane.
What is the SMILES notation for N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane?
The canonical SMILES for N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane is C/C=C/CNC(=O)C1CCC1.CC.
What is the InChIKey of N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane?
The InChIKey is FYONLDZFRBWSAW-SQQVDAMQSA-N. The full InChI is InChI=1S/C9H15NO.C2H6/c1-2-3-7-10-9(11)8-5-4-6-8;1-2/h2-3,8H,4-7H2,1H3,(H,10,11);1-2H3/b3-2+;.
What are the key properties of N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane?
N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane has a molecular weight of 183.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-but-2-enyl]cyclobutanecarboxamide;ethane is sourced from PubChem (CID 178010302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).