C11H21NO3 — CID 178010742
N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide;ethane (PubChem CID 178010742) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide;ethane.
| Compound Name | N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide;ethane |
|---|---|
| PubChem CID | 178010742 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-[(E)-but-2-enyl]-1,4-dioxane-2-carboxamide;ethane |
| SMILES | C/C=C/CNC(=O)C1COCCO1.CC |
| InChI | InChI=1S/C9H15NO3.C2H6/c1-2-3-4-10-9(11)8-7-12-5-6-13-8;1-2/h2-3,8H,4-7H2,1H3,(H,10,11);1-2H3/b3-2+; |
| InChIKey | IUFOIVVXEIHNGD-SQQVDAMQSA-N |
| XLogP | 1.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|