C15H14F2O3 — CID 178012628
1-[(1R)-2,2-difluorocyclopropyl]-3-(4-prop-2-enoxyphenyl)propane-1,3-dione (PubChem CID 178012628) has the molecular formula C15H14F2O3 and a molecular weight of 280.27 g/mol. Its IUPAC name is 1-[(1R)-2,2-difluorocyclopropyl]-3-(4-prop-2-enoxyphenyl)propane-1,3-dione.
| Compound Name | 1-[(1R)-2,2-difluorocyclopropyl]-3-(4-prop-2-enoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 178012628 |
| Molecular Formula | C15H14F2O3 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-[(1R)-2,2-difluorocyclopropyl]-3-(4-prop-2-enoxyphenyl)propane-1,3-dione |
| SMILES | C=CCOc1ccc(C(=O)CC(=O)[C@H]2CC2(F)F)cc1 |
| InChI | InChI=1S/C15H14F2O3/c1-2-7-20-11-5-3-10(4-6-11)13(18)8-14(19)12-9-15(12,16)17/h2-6,12H,1,7-9H2/t12-/m1/s1 |
| InChIKey | CBZWJUDSCLDIPM-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|