C25H27F3N5O3PS — CID 178019239
(3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-phosphanylphenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 178019239) has the molecular formula C25H27F3N5O3PS and a molecular weight of 565.56 g/mol. Its IUPAC name is (3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-phosphanylphenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-phosphanylphenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 178019239 |
| Molecular Formula | C25H27F3N5O3PS |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | (3Z)-1-[4-(N-butylidenecarbamimidoyl)-2-phosphanylphenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | [H]/N=C(\N=C\CCC)c1ccc(NC(=O)/N=C2\SCC(=O)N2c2cc(C)ccc2COCC(F)(F)F)c(P)c1 |
| InChI | InChI=1S/C25H27F3N5O3PS/c1-3-4-9-30-22(29)16-7-8-18(20(37)11-16)31-23(35)32-24-33(21(34)13-38-24)19-10-15(2)5-6-17(19)12-36-14-25(26,27)28/h5-11,29H,3-4,12-14,37H2,1-2H3,(H,31,35)/b29-22-,30-9+,32-24- |
| InChIKey | XVOZYVAUMRYYKF-MJBAIMNUSA-N |
| XLogP | 5.44 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|