C17H30N2 — CID 178028612
ethane;2-[[[(3E,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]amino]methyl]butanenitrile (PubChem CID 178028612) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is ethane;2-[[[(3E,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]amino]methyl]butanenitrile.
| Compound Name | ethane;2-[[[(3E,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]amino]methyl]butanenitrile |
|---|---|
| PubChem CID | 178028612 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | ethane;2-[[[(3E,5Z)-3-propan-2-ylhepta-1,3,5-trien-2-yl]amino]methyl]butanenitrile |
| SMILES | C=C(NCC(C#N)CC)/C(=C/C=C\C)C(C)C.CC |
| InChI | InChI=1S/C15H24N2.C2H6/c1-6-8-9-15(12(3)4)13(5)17-11-14(7-2)10-16;1-2/h6,8-9,12,14,17H,5,7,11H2,1-4H3;1-2H3/b8-6-,15-9+; |
| InChIKey | GUAPUGLHMFGZRF-JBRUHATBSA-N |
| XLogP | 4.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|