C14H19BrN3O4P — CID 178029170
tert-butyl N-[2-(5-bromo-2-carbamoyl-4-phosphanylanilino)-2-oxoethyl]carbamate (PubChem CID 178029170) has the molecular formula C14H19BrN3O4P and a molecular weight of 404.20 g/mol. Its IUPAC name is tert-butyl N-[2-(5-bromo-2-carbamoyl-4-phosphanylanilino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-bromo-2-carbamoyl-4-phosphanylanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 178029170 |
| Molecular Formula | C14H19BrN3O4P |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | tert-butyl N-[2-(5-bromo-2-carbamoyl-4-phosphanylanilino)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1cc(Br)c(P)cc1C(N)=O |
| InChI | InChI=1S/C14H19BrN3O4P/c1-14(2,3)22-13(21)17-6-11(19)18-9-5-8(15)10(23)4-7(9)12(16)20/h4-5H,6,23H2,1-3H3,(H2,16,20)(H,17,21)(H,18,19) |
| InChIKey | XUBVTURFOLHXPO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|