C24H39N3 — CID 178037072
5-cyclohexa-1,5-dien-1-yl-1,2,3,6-tetrahydropyridine;ethane;(E)-N-methyl-4-(1,2,3,6-tetrahydropyridin-5-yl)pent-3-en-2-imine (PubChem CID 178037072) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-1,2,3,6-tetrahydropyridine;ethane;(E)-N-methyl-4-(1,2,3,6-tetrahydropyridin-5-yl)pent-3-en-2-imine.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-1,2,3,6-tetrahydropyridine;ethane;(E)-N-methyl-4-(1,2,3,6-tetrahydropyridin-5-yl)pent-3-en-2-imine |
|---|---|
| PubChem CID | 178037072 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-1,2,3,6-tetrahydropyridine;ethane;(E)-N-methyl-4-(1,2,3,6-tetrahydropyridin-5-yl)pent-3-en-2-imine |
| SMILES | C/N=C(C)/C=C(\C)C1=CCCNC1.C1=CC(C2=CCCNC2)=CCC1.CC |
| InChI | InChI=1S/C11H18N2.C11H15N.C2H6/c1-9(7-10(2)12-3)11-5-4-6-13-8-11;1-2-5-10(6-3-1)11-7-4-8-12-9-11;1-2/h5,7,13H,4,6,8H2,1-3H3;2,5-7,12H,1,3-4,8-9H2;1-2H3/b9-7+,12-10+;; |
| InChIKey | ZAFHOBIRTLUGJK-DBYDZZTOSA-N |
| XLogP | 5.15 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|