C15H30F3N — CID 178040100
butane;ethane;(Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine (PubChem CID 178040100) has the molecular formula C15H30F3N and a molecular weight of 281.41 g/mol. Its IUPAC name is butane;ethane;(Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine.
| Compound Name | butane;ethane;(Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine |
|---|---|
| PubChem CID | 178040100 |
| Molecular Formula | C15H30F3N |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | butane;ethane;(Z)-N-methyl-4-(2,2,2-trifluoroethyl)hex-4-en-3-imine |
| SMILES | C/C=C(CC(F)(F)F)\C(CC)=N\C.CC.CCCC |
| InChI | InChI=1S/C9H14F3N.C4H10.C2H6/c1-4-7(6-9(10,11)12)8(5-2)13-3;1-3-4-2;1-2/h4H,5-6H2,1-3H3;3-4H2,1-2H3;1-2H3/b7-4-,13-8+;; |
| InChIKey | FEVOBTIATXHZFG-VYGSWWIZSA-N |
| XLogP | 6.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|