C15H11F3N2O4S — CID 178048051
4-[3-hydroxy-2-oxo-4-(trifluoromethyl)-1H-indol-3-yl]benzenesulfonamide (PubChem CID 178048051) has the molecular formula C15H11F3N2O4S and a molecular weight of 372.32 g/mol. Its IUPAC name is 4-[3-hydroxy-2-oxo-4-(trifluoromethyl)-1H-indol-3-yl]benzenesulfonamide.
| Compound Name | 4-[3-hydroxy-2-oxo-4-(trifluoromethyl)-1H-indol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 178048051 |
| Molecular Formula | C15H11F3N2O4S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 4-[3-hydroxy-2-oxo-4-(trifluoromethyl)-1H-indol-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2(O)C(=O)Nc3cccc(C(F)(F)F)c32)cc1 |
| InChI | InChI=1S/C15H11F3N2O4S/c16-15(17,18)10-2-1-3-11-12(10)14(22,13(21)20-11)8-4-6-9(7-5-8)25(19,23)24/h1-7,22H,(H,20,21)(H2,19,23,24) |
| InChIKey | GTLIWWUDJYQJCW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |