C31H47N5O11 — CID 178048277
2-[[6-[2-[[5-(carbamoylamino)-2-(3-methylbutanoylamino)pentanoyl]amino]-5-(2-methylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carbonyl]-methylamino]acetic acid (PubChem CID 178048277) has the molecular formula C31H47N5O11 and a molecular weight of 665.74 g/mol. Its IUPAC name is 2-[[6-[2-[[5-(carbamoylamino)-2-(3-methylbutanoylamino)pentanoyl]amino]-5-(2-methylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carbonyl]-methylamino]acetic acid.
| Compound Name | 2-[[6-[2-[[5-(carbamoylamino)-2-(3-methylbutanoylamino)pentanoyl]amino]-5-(2-methylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carbonyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 178048277 |
| Molecular Formula | C31H47N5O11 |
| Molecular Weight | 665.74 g/mol |
| Exact Mass | 665.33 |
| IUPAC Name | 2-[[6-[2-[[5-(carbamoylamino)-2-(3-methylbutanoylamino)pentanoyl]amino]-5-(2-methylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carbonyl]-methylamino]acetic acid |
| SMILES | CC(C)CC(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)C(C)C)cc1OC1CC(O)CC(C(=O)N(C)CC(=O)O)O1 |
| InChI | InChI=1S/C31H47N5O11/c1-17(2)11-25(38)34-22(7-6-10-33-31(32)44)28(41)35-21-9-8-19(16-45-30(43)18(3)4)12-23(21)46-27-14-20(37)13-24(47-27)29(42)36(5)15-26(39)40/h8-9,12,17-18,20,22,24,27,37H,6-7,10-11,13-16H2,1-5H3,(H,34,38)(H,35,41)(H,39,40)(H3,32,33,44) |
| InChIKey | RUTGOOGKJYRBFH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 235.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|