C24H39N5O8 — CID 178048139
(2S)-2-[5-(acetyloxymethyl)-2-[[(2R)-5-(carbamoylamino)-2-[[(2R)-1-hydroxy-3-methyl-2-(methylamino)butyl]amino]pentanoyl]amino]phenoxy]propanoic acid (PubChem CID 178048139) has the molecular formula C24H39N5O8 and a molecular weight of 525.60 g/mol. Its IUPAC name is (2S)-2-[5-(acetyloxymethyl)-2-[[(2R)-5-(carbamoylamino)-2-[[(2R)-1-hydroxy-3-methyl-2-(methylamino)butyl]amino]pentanoyl]amino]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[5-(acetyloxymethyl)-2-[[(2R)-5-(carbamoylamino)-2-[[(2R)-1-hydroxy-3-methyl-2-(methylamino)butyl]amino]pentanoyl]amino]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 178048139 |
| Molecular Formula | C24H39N5O8 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | (2S)-2-[5-(acetyloxymethyl)-2-[[(2R)-5-(carbamoylamino)-2-[[(2R)-1-hydroxy-3-methyl-2-(methylamino)butyl]amino]pentanoyl]amino]phenoxy]propanoic acid |
| SMILES | CN[C@H](C(C)C)C(O)N[C@H](CCCNC(N)=O)C(=O)Nc1ccc(COC(C)=O)cc1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C24H39N5O8/c1-13(2)20(26-5)22(32)29-18(7-6-10-27-24(25)35)21(31)28-17-9-8-16(12-36-15(4)30)11-19(17)37-14(3)23(33)34/h8-9,11,13-14,18,20,22,26,29,32H,6-7,10,12H2,1-5H3,(H,28,31)(H,33,34)(H3,25,27,35)/t14-,18+,20+,22?/m0/s1 |
| InChIKey | UCMXUGGWJPTMES-YUNBXNTBSA-N |
| XLogP | 0.51 |
| TPSA | 201.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|