C28H53N2O12P — CID 178052209
2,2-dimethylpropanal;[3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]propyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;2-methoxyethanol (PubChem CID 178052209) has the molecular formula C28H53N2O12P and a molecular weight of 640.71 g/mol. Its IUPAC name is 2,2-dimethylpropanal;[3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]propyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;2-methoxyethanol.
| Compound Name | 2,2-dimethylpropanal;[3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]propyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;2-methoxyethanol |
|---|---|
| PubChem CID | 178052209 |
| Molecular Formula | C28H53N2O12P |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 2,2-dimethylpropanal;[3-[5-[formyl-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]amino]oxolan-2-yl]propyl-(methoxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate;2-methoxyethanol |
| SMILES | CC(C)(C)C=O.CNC(=O)/C=C\N(C=O)C1CCC(CCCP(=O)(OCOC)OCOC(=O)C(C)(C)C)O1.COCCO |
| InChI | InChI=1S/C20H35N2O9P.C5H10O.C3H8O2/c1-20(2,3)19(25)28-15-30-32(26,29-14-27-5)12-6-7-16-8-9-18(31-16)22(13-23)11-10-17(24)21-4;1-5(2,3)4-6;1-5-3-2-4/h10-11,13,16,18H,6-9,12,14-15H2,1-5H3,(H,21,24);4H,1-3H3;4H,2-3H2,1H3/b11-10-;; |
| InChIKey | AOOYBQZARJDRIL-PQBRBDCOSA-N |
| XLogP | 3.22 |
| TPSA | 176.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|