C15H28FN3O3 — CID 178059474
tert-butyl 3-[2-(diethylamino)ethylcarbamoyl]-3-fluoroazetidine-1-carboxylate (PubChem CID 178059474) has the molecular formula C15H28FN3O3 and a molecular weight of 317.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(diethylamino)ethylcarbamoyl]-3-fluoroazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(diethylamino)ethylcarbamoyl]-3-fluoroazetidine-1-carboxylate |
|---|---|
| PubChem CID | 178059474 |
| Molecular Formula | C15H28FN3O3 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl 3-[2-(diethylamino)ethylcarbamoyl]-3-fluoroazetidine-1-carboxylate |
| SMILES | CCN(CC)CCNC(=O)C1(F)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28FN3O3/c1-6-18(7-2)9-8-17-12(20)15(16)10-19(11-15)13(21)22-14(3,4)5/h6-11H2,1-5H3,(H,17,20) |
| InChIKey | GHXNMMXYWHSPJK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |