C9H15Cl3O3Si — CID 178066722
2-(4-trichlorosilylbutoxy)ethyl prop-2-enoate (PubChem CID 178066722) has the molecular formula C9H15Cl3O3Si and a molecular weight of 305.66 g/mol. Its IUPAC name is 2-(4-trichlorosilylbutoxy)ethyl prop-2-enoate.
| Compound Name | 2-(4-trichlorosilylbutoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 178066722 |
| Molecular Formula | C9H15Cl3O3Si |
| Molecular Weight | 305.66 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-(4-trichlorosilylbutoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15Cl3O3Si/c1-2-9(13)15-7-6-14-5-3-4-8-16(10,11)12/h2H,1,3-8H2 |
| InChIKey | BWQVDAIZIHNQDC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|