C19H21NO5 — CID 178068546
(2R)-6-(methoxymethoxy)-2-(4-methoxy-2-nitrophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 178068546) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2R)-6-(methoxymethoxy)-2-(4-methoxy-2-nitrophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (2R)-6-(methoxymethoxy)-2-(4-methoxy-2-nitrophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 178068546 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2R)-6-(methoxymethoxy)-2-(4-methoxy-2-nitrophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | COCOc1ccc2c(c1)CC[C@@H](c1ccc(OC)cc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C19H21NO5/c1-23-12-25-17-6-5-13-9-15(4-3-14(13)10-17)18-8-7-16(24-2)11-19(18)20(21)22/h5-8,10-11,15H,3-4,9,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | HVYTZUBABISABW-OAHLLOKOSA-N |
| XLogP | 3.86 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|