C17H22NO2P3 — CID 164775901
N-(diphosphanyl)-5-methoxy-2-(6-phosphanyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)aniline (PubChem CID 164775901) has the molecular formula C17H22NO2P3 and a molecular weight of 365.29 g/mol. Its IUPAC name is N-(diphosphanyl)-5-methoxy-2-(6-phosphanyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)aniline.
| Compound Name | N-(diphosphanyl)-5-methoxy-2-(6-phosphanyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)aniline |
|---|---|
| PubChem CID | 164775901 |
| Molecular Formula | C17H22NO2P3 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(diphosphanyl)-5-methoxy-2-(6-phosphanyloxy-1,2,3,4-tetrahydronaphthalen-2-yl)aniline |
| SMILES | COc1ccc(C2CCc3cc(OP)ccc3C2)c(NPP)c1 |
| InChI | InChI=1S/C17H22NO2P3/c1-19-14-6-7-16(17(10-14)18-23-22)13-3-2-12-9-15(20-21)5-4-11(12)8-13/h4-7,9-10,13,18,23H,2-3,8,21-22H2,1H3 |
| InChIKey | GOVHHGBBBBLBDX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|