C19H23NO3 — CID 178068998
2-[6-(methoxymethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-(trideuteriomethoxy)aniline (PubChem CID 178068998) has the molecular formula C19H23NO3 and a molecular weight of 316.42 g/mol. Its IUPAC name is 2-[6-(methoxymethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-(trideuteriomethoxy)aniline.
| Compound Name | 2-[6-(methoxymethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-(trideuteriomethoxy)aniline |
|---|---|
| PubChem CID | 178068998 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-[6-(methoxymethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-(trideuteriomethoxy)aniline |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C2CCc3cc(OCOC)ccc3C2)c(N)c1 |
| InChI | InChI=1S/C19H23NO3/c1-21-12-23-17-6-5-13-9-15(4-3-14(13)10-17)18-8-7-16(22-2)11-19(18)20/h5-8,10-11,15H,3-4,9,12,20H2,1-2H3/i2D3 |
| InChIKey | HEYPYUSISVCUTD-BMSJAHLVSA-N |
| XLogP | 3.53 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|