C6H6Br2O2S — CID 178076239
2,3-dibromo-4,5-dimethoxythiophene (PubChem CID 178076239) has the molecular formula C6H6Br2O2S and a molecular weight of 301.99 g/mol. Its IUPAC name is 2,3-dibromo-4,5-dimethoxythiophene.
| Compound Name | 2,3-dibromo-4,5-dimethoxythiophene |
|---|---|
| PubChem CID | 178076239 |
| Molecular Formula | C6H6Br2O2S |
| Molecular Weight | 301.99 g/mol |
| Exact Mass | 299.85 |
| IUPAC Name | 2,3-dibromo-4,5-dimethoxythiophene |
| SMILES | COc1sc(Br)c(Br)c1OC |
| InChI | InChI=1S/C6H6Br2O2S/c1-9-4-3(7)5(8)11-6(4)10-2/h1-2H3 |
| InChIKey | YSWDNHJYXSCISR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |