C7H11NO3S — CID 98774107
3,4,5-trimethoxythiophen-2-amine (PubChem CID 98774107) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 3,4,5-trimethoxythiophen-2-amine.
| Compound Name | 3,4,5-trimethoxythiophen-2-amine |
|---|---|
| PubChem CID | 98774107 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3,4,5-trimethoxythiophen-2-amine |
| SMILES | COc1sc(N)c(OC)c1OC |
| InChI | InChI=1S/C7H11NO3S/c1-9-4-5(10-2)7(11-3)12-6(4)8/h8H2,1-3H3 |
| InChIKey | NSRMMXCLKANMAM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |