C6H9NO2S — CID 88979037
3,4-dimethoxythiophen-2-amine (PubChem CID 88979037) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is 3,4-dimethoxythiophen-2-amine.
| Compound Name | 3,4-dimethoxythiophen-2-amine |
|---|---|
| PubChem CID | 88979037 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3,4-dimethoxythiophen-2-amine |
| SMILES | COc1csc(N)c1OC |
| InChI | InChI=1S/C6H9NO2S/c1-8-4-3-10-6(7)5(4)9-2/h3H,7H2,1-2H3 |
| InChIKey | JSMCNMOSHOHCCK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |