C14H18O6S4 — CID 139909565
2,3,5-trimethoxy-4-[(2,4,5-trimethoxythiophen-3-yl)disulfanyl]thiophene (PubChem CID 139909565) has the molecular formula C14H18O6S4 and a molecular weight of 410.56 g/mol. Its IUPAC name is 2,3,5-trimethoxy-4-[(2,4,5-trimethoxythiophen-3-yl)disulfanyl]thiophene.
| Compound Name | 2,3,5-trimethoxy-4-[(2,4,5-trimethoxythiophen-3-yl)disulfanyl]thiophene |
|---|---|
| PubChem CID | 139909565 |
| Molecular Formula | C14H18O6S4 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2,3,5-trimethoxy-4-[(2,4,5-trimethoxythiophen-3-yl)disulfanyl]thiophene |
| SMILES | COc1sc(OC)c(SSc2c(OC)sc(OC)c2OC)c1OC |
| InChI | InChI=1S/C14H18O6S4/c1-15-7-9(13(19-5)21-11(7)17-3)23-24-10-8(16-2)12(18-4)22-14(10)20-6/h1-6H3 |
| InChIKey | UEXPDCLFKPRHEB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|