C27H28O8S2 — CID 178076443
[3,5-bis(benzylsulfonyloxy)cyclohexyl] benzoate (PubChem CID 178076443) has the molecular formula C27H28O8S2 and a molecular weight of 544.65 g/mol. Its IUPAC name is [3,5-bis(benzylsulfonyloxy)cyclohexyl] benzoate.
| Compound Name | [3,5-bis(benzylsulfonyloxy)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 178076443 |
| Molecular Formula | C27H28O8S2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [3,5-bis(benzylsulfonyloxy)cyclohexyl] benzoate |
| SMILES | O=C(OC1CC(OS(=O)(=O)Cc2ccccc2)CC(OS(=O)(=O)Cc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C27H28O8S2/c28-27(23-14-8-3-9-15-23)33-24-16-25(34-36(29,30)19-21-10-4-1-5-11-21)18-26(17-24)35-37(31,32)20-22-12-6-2-7-13-22/h1-15,24-26H,16-20H2 |
| InChIKey | CCZAAYRBLCVROC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|