C25H24N4O8S — CID 178078545
2-[4-(4-ethoxy-1-methyl-2,2-dioxo-2λ6,1-benzothiazine-7-carbonyl)-1,3-dimethylpyrazol-5-yl]oxy-1-(4-nitrophenyl)ethanone (PubChem CID 178078545) has the molecular formula C25H24N4O8S and a molecular weight of 540.55 g/mol. Its IUPAC name is 2-[4-(4-ethoxy-1-methyl-2,2-dioxo-2λ6,1-benzothiazine-7-carbonyl)-1,3-dimethylpyrazol-5-yl]oxy-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-[4-(4-ethoxy-1-methyl-2,2-dioxo-2λ6,1-benzothiazine-7-carbonyl)-1,3-dimethylpyrazol-5-yl]oxy-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 178078545 |
| Molecular Formula | C25H24N4O8S |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-[4-(4-ethoxy-1-methyl-2,2-dioxo-2λ6,1-benzothiazine-7-carbonyl)-1,3-dimethylpyrazol-5-yl]oxy-1-(4-nitrophenyl)ethanone |
| SMILES | CCOC1=CS(=O)(=O)N(C)c2cc(C(=O)c3c(C)nn(C)c3OCC(=O)c3ccc([N+](=O)[O-])cc3)ccc21 |
| InChI | InChI=1S/C25H24N4O8S/c1-5-36-22-14-38(34,35)28(4)20-12-17(8-11-19(20)22)24(31)23-15(2)26-27(3)25(23)37-13-21(30)16-6-9-18(10-7-16)29(32)33/h6-12,14H,5,13H2,1-4H3 |
| InChIKey | CVOMLEBYHWAPJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 150.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|