C19H29BrF2OSi — CID 178080159
[(E)-3-(4-bromo-2,3-difluorophenyl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane (PubChem CID 178080159) has the molecular formula C19H29BrF2OSi and a molecular weight of 419.43 g/mol. Its IUPAC name is [(E)-3-(4-bromo-2,3-difluorophenyl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E)-3-(4-bromo-2,3-difluorophenyl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 178080159 |
| Molecular Formula | C19H29BrF2OSi |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [(E)-3-(4-bromo-2,3-difluorophenyl)-2-methylprop-2-enoxy]-tri(propan-2-yl)silane |
| SMILES | C/C(=C\c1ccc(Br)c(F)c1F)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H29BrF2OSi/c1-12(2)24(13(3)4,14(5)6)23-11-15(7)10-16-8-9-17(20)19(22)18(16)21/h8-10,12-14H,11H2,1-7H3/b15-10+ |
| InChIKey | GTMASNONMSNNJA-XNTDXEJSSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|