C13H23N — CID 178086643
1,4-dimethyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydropyrrole;ethane (PubChem CID 178086643) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 1,4-dimethyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydropyrrole;ethane.
| Compound Name | 1,4-dimethyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydropyrrole;ethane |
|---|---|
| PubChem CID | 178086643 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 1,4-dimethyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-2,3-dihydropyrrole;ethane |
| SMILES | C=C/C(C)=C\C1=C(C)CCN1C.CC |
| InChI | InChI=1S/C11H17N.C2H6/c1-5-9(2)8-11-10(3)6-7-12(11)4;1-2/h5,8H,1,6-7H2,2-4H3;1-2H3/b9-8-; |
| InChIKey | VOGITLDGXKKAOE-UOQXYWCXSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|