C14H21FO — CID 178088930
2-(1-ethoxybutyl)-1-fluoro-3,5-dimethylbenzene (PubChem CID 178088930) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-(1-ethoxybutyl)-1-fluoro-3,5-dimethylbenzene.
| Compound Name | 2-(1-ethoxybutyl)-1-fluoro-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 178088930 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-(1-ethoxybutyl)-1-fluoro-3,5-dimethylbenzene |
| SMILES | CCCC(OCC)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C14H21FO/c1-5-7-13(16-6-2)14-11(4)8-10(3)9-12(14)15/h8-9,13H,5-7H2,1-4H3 |
| InChIKey | YHEYUBDHNZOMGH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |