C51H92N2O5 — CID 178090022
[(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 178090022) has the molecular formula C51H92N2O5 and a molecular weight of 813.31 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 178090022 |
| Molecular Formula | C51H92N2O5 |
| Molecular Weight | 813.31 g/mol |
| Exact Mass | 812.70 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)(OC(=O)CCCNC(=O)OC(C)(C)C)C(=O)NCCCC |
| InChI | InChI=1S/C51H92N2O5/c1-7-10-13-15-17-19-21-23-25-27-29-31-33-35-37-39-43-51(48(55)52-45-12-9-3,57-47(54)42-41-46-53-49(56)58-50(4,5)6)44-40-38-36-34-32-30-28-26-24-22-20-18-16-14-11-8-2/h17-20,23-26H,7-16,21-22,27-46H2,1-6H3,(H,52,55)(H,53,56)/b19-17-,20-18-,25-23-,26-24- |
| InChIKey | JVBXMENHRYKTEC-XHFJISOBSA-N |
| XLogP | 14.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.31 |
| LogP ≤ 5 | 14.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|