C50H90N2O3 — CID 178089983
[(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 1,3-dimethylpiperidine-4-carboxylate (PubChem CID 178089983) has the molecular formula C50H90N2O3 and a molecular weight of 767.28 g/mol. Its IUPAC name is [(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 1,3-dimethylpiperidine-4-carboxylate.
| Compound Name | [(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 1,3-dimethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 178089983 |
| Molecular Formula | C50H90N2O3 |
| Molecular Weight | 767.28 g/mol |
| Exact Mass | 766.70 |
| IUPAC Name | [(6Z,9Z,28Z,31Z)-19-(butylcarbamoyl)heptatriaconta-6,9,28,31-tetraen-19-yl] 1,3-dimethylpiperidine-4-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)(OC(=O)C1CCN(C)CC1C)C(=O)NCCCC |
| InChI | InChI=1S/C50H90N2O3/c1-6-9-12-14-16-18-20-22-24-26-28-30-32-34-36-38-41-50(49(54)51-43-11-8-3,55-48(53)47-40-44-52(5)45-46(47)4)42-39-37-35-33-31-29-27-25-23-21-19-17-15-13-10-7-2/h16-19,22-25,46-47H,6-15,20-21,26-45H2,1-5H3,(H,51,54)/b18-16-,19-17-,24-22-,25-23- |
| InChIKey | VHCLOFIGHQPAQZ-HBZIWDQGSA-N |
| XLogP | 14.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.28 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|