C29H41N3O2S — CID 178094222
4-N-(4-butylsulfanyl-3-methylphenyl)-6-N,6-N-dimethyl-7-(oxolan-3-ylmethoxy)quinoline-4,6-diamine;ethane (PubChem CID 178094222) has the molecular formula C29H41N3O2S and a molecular weight of 495.73 g/mol. Its IUPAC name is 4-N-(4-butylsulfanyl-3-methylphenyl)-6-N,6-N-dimethyl-7-(oxolan-3-ylmethoxy)quinoline-4,6-diamine;ethane.
| Compound Name | 4-N-(4-butylsulfanyl-3-methylphenyl)-6-N,6-N-dimethyl-7-(oxolan-3-ylmethoxy)quinoline-4,6-diamine;ethane |
|---|---|
| PubChem CID | 178094222 |
| Molecular Formula | C29H41N3O2S |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 4-N-(4-butylsulfanyl-3-methylphenyl)-6-N,6-N-dimethyl-7-(oxolan-3-ylmethoxy)quinoline-4,6-diamine;ethane |
| SMILES | CC.CCCCSc1ccc(Nc2ccnc3cc(OCC4CCOC4)c(N(C)C)cc23)cc1C |
| InChI | InChI=1S/C27H35N3O2S.C2H6/c1-5-6-13-33-27-8-7-21(14-19(27)2)29-23-9-11-28-24-16-26(25(30(3)4)15-22(23)24)32-18-20-10-12-31-17-20;1-2/h7-9,11,14-16,20H,5-6,10,12-13,17-18H2,1-4H3,(H,28,29);1-2H3 |
| InChIKey | HJUQYFWXHZCJHX-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|